C8H9BrF2N2 — CID 171313620
(1R)-1-(2-bromo-3-pyridinyl)-3,3-difluoropropan-1-amine (PubChem CID 171313620) has the molecular formula C8H9BrF2N2 and a molecular weight of 251.07 g/mol. Its IUPAC name is (1R)-1-(2-bromo-3-pyridinyl)-3,3-difluoropropan-1-amine.
| Compound Name | (1R)-1-(2-bromo-3-pyridinyl)-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 171313620 |
| Molecular Formula | C8H9BrF2N2 |
| Molecular Weight | 251.07 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | (1R)-1-(2-bromo-3-pyridinyl)-3,3-difluoropropan-1-amine |
| SMILES | N[C@H](CC(F)F)c1cccnc1Br |
| InChI | InChI=1S/C8H9BrF2N2/c9-8-5(2-1-3-13-8)6(12)4-7(10)11/h1-3,6-7H,4,12H2/t6-/m1/s1 |
| InChIKey | HXCFCABBBLRWTA-ZCFIWIBFSA-N |
| XLogP | 2.50 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.07 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|