C7H6BrF3N2 — CID 97290353
(1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine (PubChem CID 97290353) has the molecular formula C7H6BrF3N2 and a molecular weight of 255.04 g/mol. Its IUPAC name is (1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine.
| Compound Name | (1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 97290353 |
| Molecular Formula | C7H6BrF3N2 |
| Molecular Weight | 255.04 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | (1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine |
| SMILES | N[C@@H](c1cccnc1Br)C(F)(F)F |
| InChI | InChI=1S/C7H6BrF3N2/c8-6-4(2-1-3-13-6)5(12)7(9,10)11/h1-3,5H,12H2/t5-/m0/s1 |
| InChIKey | GMMQHKBDGCGMCM-YFKPBYRVSA-N |
| XLogP | 2.41 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.04 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|