About (1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine
(1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine (PubChem CID 97290353) has the molecular formula C7H6BrF3N2
and a molecular weight of 255.04 g/mol. Its IUPAC name is (1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine.
Molecular Properties
| Compound Name | (1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine |
| PubChem CID | 97290353 |
| Molecular Formula | C7H6BrF3N2 |
| Molecular Weight | 255.04 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | (1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine |
| SMILES | N[C@@H](c1cccnc1Br)C(F)(F)F |
| InChI | InChI=1S/C7H6BrF3N2/c8-6-4(2-1-3-13-6)5(12)7(9,10)11/h1-3,5H,12H2/t5-/m0/s1 |
| InChIKey | GMMQHKBDGCGMCM-YFKPBYRVSA-N |
| XLogP | 2.41 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.04 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine?
The IUPAC name of (1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine (CID 97290353) is (1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine.
What is the SMILES notation for (1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine?
The canonical SMILES for (1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine is N[C@@H](c1cccnc1Br)C(F)(F)F.
What is the InChIKey of (1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine?
The InChIKey is GMMQHKBDGCGMCM-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H6BrF3N2/c8-6-4(2-1-3-13-6)5(12)7(9,10)11/h1-3,5H,12H2/t5-/m0/s1.
What are the key properties of (1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine?
(1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine has a molecular weight of 255.04 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(2-bromo-3-pyridinyl)-2,2,2-trifluoroethanamine is sourced from PubChem (CID 97290353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).