C8H7BrClF5N2 — CID 171311578
(1S)-1-(2-bromo-3-pyridinyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride (PubChem CID 171311578) has the molecular formula C8H7BrClF5N2 and a molecular weight of 341.51 g/mol. Its IUPAC name is (1S)-1-(2-bromo-3-pyridinyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(2-bromo-3-pyridinyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171311578 |
| Molecular Formula | C8H7BrClF5N2 |
| Molecular Weight | 341.51 g/mol |
| Exact Mass | 339.94 |
| IUPAC Name | (1S)-1-(2-bromo-3-pyridinyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H](c1cccnc1Br)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H6BrF5N2.ClH/c9-6-4(2-1-3-16-6)5(15)7(10,11)8(12,13)14;/h1-3,5H,15H2;1H/t5-;/m0./s1 |
| InChIKey | YINHRHMRRLKPSF-JEDNCBNOSA-N |
| XLogP | 3.46 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|