C9H8F5NO — CID 131473410
2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]phenol (PubChem CID 131473410) has the molecular formula C9H8F5NO and a molecular weight of 241.16 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]phenol.
| Compound Name | 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]phenol |
|---|---|
| PubChem CID | 131473410 |
| Molecular Formula | C9H8F5NO |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-[(1S)-1-amino-2,2,3,3,3-pentafluoropropyl]phenol |
| SMILES | N[C@@H](c1ccccc1O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8F5NO/c10-8(11,9(12,13)14)7(15)5-3-1-2-4-6(5)16/h1-4,7,16H,15H2/t7-/m0/s1 |
| InChIKey | JEMDJTKSBZZDOL-ZETCQYMHSA-N |
| XLogP | 2.59 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|