C10H11ClF5NO — CID 171312254
2-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]-4-methylphenol;hydrochloride (PubChem CID 171312254) has the molecular formula C10H11ClF5NO and a molecular weight of 291.65 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]-4-methylphenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]-4-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171312254 |
| Molecular Formula | C10H11ClF5NO |
| Molecular Weight | 291.65 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 2-[(1R)-1-amino-2,2,3,3,3-pentafluoropropyl]-4-methylphenol;hydrochloride |
| SMILES | Cc1ccc(O)c([C@@H](N)C(F)(F)C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C10H10F5NO.ClH/c1-5-2-3-7(17)6(4-5)8(16)9(11,12)10(13,14)15;/h2-4,8,17H,16H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | WKHACISFWAZCPD-DDWIOCJRSA-N |
| XLogP | 3.32 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.65 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|