C13H20ClNO3 — CID 171240436
methyl (3R)-3-amino-3-(2-hydroxy-5-methylphenyl)-2,2-dimethylpropanoate;hydrochloride (PubChem CID 171240436) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(2-hydroxy-5-methylphenyl)-2,2-dimethylpropanoate;hydrochloride.
| Compound Name | methyl (3R)-3-amino-3-(2-hydroxy-5-methylphenyl)-2,2-dimethylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 171240436 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | methyl (3R)-3-amino-3-(2-hydroxy-5-methylphenyl)-2,2-dimethylpropanoate;hydrochloride |
| SMILES | COC(=O)C(C)(C)[C@H](N)c1cc(C)ccc1O.Cl |
| InChI | InChI=1S/C13H19NO3.ClH/c1-8-5-6-10(15)9(7-8)11(14)13(2,3)12(16)17-4;/h5-7,11,15H,14H2,1-4H3;1H/t11-;/m1./s1 |
| InChIKey | JQVAFNKKPYEJCN-RFVHGSKJSA-N |
| XLogP | 2.32 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|