C12H18ClNO4 — CID 171239936
methyl (3R)-3-amino-3-(2,3-dihydroxyphenyl)-2,2-dimethylpropanoate;hydrochloride (PubChem CID 171239936) has the molecular formula C12H18ClNO4 and a molecular weight of 275.73 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(2,3-dihydroxyphenyl)-2,2-dimethylpropanoate;hydrochloride.
| Compound Name | methyl (3R)-3-amino-3-(2,3-dihydroxyphenyl)-2,2-dimethylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 171239936 |
| Molecular Formula | C12H18ClNO4 |
| Molecular Weight | 275.73 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | methyl (3R)-3-amino-3-(2,3-dihydroxyphenyl)-2,2-dimethylpropanoate;hydrochloride |
| SMILES | COC(=O)C(C)(C)[C@H](N)c1cccc(O)c1O.Cl |
| InChI | InChI=1S/C12H17NO4.ClH/c1-12(2,11(16)17-3)10(13)7-5-4-6-8(14)9(7)15;/h4-6,10,14-15H,13H2,1-3H3;1H/t10-;/m1./s1 |
| InChIKey | QIXJDZIYEFHNOY-HNCPQSOCSA-N |
| XLogP | 1.72 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.73 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|