C11H15ClN2O2 — CID 171239153
methyl (3S)-3-amino-3-(2-chloro-3-pyridinyl)-2,2-dimethylpropanoate (PubChem CID 171239153) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(2-chloro-3-pyridinyl)-2,2-dimethylpropanoate.
| Compound Name | methyl (3S)-3-amino-3-(2-chloro-3-pyridinyl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 171239153 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | methyl (3S)-3-amino-3-(2-chloro-3-pyridinyl)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)[C@H](N)c1cccnc1Cl |
| InChI | InChI=1S/C11H15ClN2O2/c1-11(2,10(15)16-3)8(13)7-5-4-6-14-9(7)12/h4-6,8H,13H2,1-3H3/t8-/m1/s1 |
| InChIKey | OOAPZPSPWXECKZ-MRVPVSSYSA-N |
| XLogP | 1.93 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|