C8H8F3NO — CID 55277980
2-[(1R)-1-amino-2,2,2-trifluoroethyl]phenol (PubChem CID 55277980) has the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2,2-trifluoroethyl]phenol.
| Compound Name | 2-[(1R)-1-amino-2,2,2-trifluoroethyl]phenol |
|---|---|
| PubChem CID | 55277980 |
| Molecular Formula | C8H8F3NO |
| Molecular Weight | 191.15 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 2-[(1R)-1-amino-2,2,2-trifluoroethyl]phenol |
| SMILES | N[C@H](c1ccccc1O)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO/c9-8(10,11)7(12)5-3-1-2-4-6(5)13/h1-4,7,13H,12H2/t7-/m1/s1 |
| InChIKey | CAJCNRNFQRHXOB-SSDOTTSWSA-N |
| XLogP | 1.95 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.15 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|