C8H8F3NO2 — CID 66510899
2-[(1S)-1-amino-2,2,2-trifluoroethyl]benzene-1,3-diol (PubChem CID 66510899) has the molecular formula C8H8F3NO2 and a molecular weight of 207.15 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2,2,2-trifluoroethyl]benzene-1,3-diol.
| Compound Name | 2-[(1S)-1-amino-2,2,2-trifluoroethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 66510899 |
| Molecular Formula | C8H8F3NO2 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 2-[(1S)-1-amino-2,2,2-trifluoroethyl]benzene-1,3-diol |
| SMILES | N[C@@H](c1c(O)cccc1O)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO2/c9-8(10,11)7(12)6-4(13)2-1-3-5(6)14/h1-3,7,13-14H,12H2/t7-/m0/s1 |
| InChIKey | WDHJWRPWSOEBNT-ZETCQYMHSA-N |
| XLogP | 1.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|