C8H9ClF3NO3 — CID 171252076
2-[(1S)-1-amino-2,2,2-trifluoroethyl]benzene-1,3,5-triol;hydrochloride (PubChem CID 171252076) has the molecular formula C8H9ClF3NO3 and a molecular weight of 259.61 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2,2,2-trifluoroethyl]benzene-1,3,5-triol;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-2,2,2-trifluoroethyl]benzene-1,3,5-triol;hydrochloride |
|---|---|
| PubChem CID | 171252076 |
| Molecular Formula | C8H9ClF3NO3 |
| Molecular Weight | 259.61 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 2-[(1S)-1-amino-2,2,2-trifluoroethyl]benzene-1,3,5-triol;hydrochloride |
| SMILES | Cl.N[C@@H](c1c(O)cc(O)cc1O)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO3.ClH/c9-8(10,11)7(12)6-4(14)1-3(13)2-5(6)15;/h1-2,7,13-15H,12H2;1H/t7-;/m0./s1 |
| InChIKey | QESJTXGTDGJFNZ-FJXQXJEOSA-N |
| XLogP | 1.79 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.61 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|