C8H9ClF3NO — CID 171238998
3-[(1R)-1-amino-2,2,2-trifluoroethyl]phenol;hydrochloride (PubChem CID 171238998) has the molecular formula C8H9ClF3NO and a molecular weight of 227.61 g/mol. Its IUPAC name is 3-[(1R)-1-amino-2,2,2-trifluoroethyl]phenol;hydrochloride.
| Compound Name | 3-[(1R)-1-amino-2,2,2-trifluoroethyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171238998 |
| Molecular Formula | C8H9ClF3NO |
| Molecular Weight | 227.61 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 3-[(1R)-1-amino-2,2,2-trifluoroethyl]phenol;hydrochloride |
| SMILES | Cl.N[C@H](c1cccc(O)c1)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO.ClH/c9-8(10,11)7(12)5-2-1-3-6(13)4-5;/h1-4,7,13H,12H2;1H/t7-;/m1./s1 |
| InChIKey | DWIZMZPZAPUNKE-OGFXRTJISA-N |
| XLogP | 2.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.61 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |