C14H13ClF3NO — CID 171239754
(1R)-2,2,2-trifluoro-1-(3-phenoxyphenyl)ethanamine;hydrochloride (PubChem CID 171239754) has the molecular formula C14H13ClF3NO and a molecular weight of 303.71 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(3-phenoxyphenyl)ethanamine;hydrochloride.
| Compound Name | (1R)-2,2,2-trifluoro-1-(3-phenoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171239754 |
| Molecular Formula | C14H13ClF3NO |
| Molecular Weight | 303.71 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(3-phenoxyphenyl)ethanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1cccc(Oc2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C14H12F3NO.ClH/c15-14(16,17)13(18)10-5-4-8-12(9-10)19-11-6-2-1-3-7-11;/h1-9,13H,18H2;1H/t13-;/m1./s1 |
| InChIKey | BWSQPXROOGNIPR-BTQNPOSSSA-N |
| XLogP | 4.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.71 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |