C15H10F3O3- — CID 21311724
3,3,3-trifluoro-2-(3-phenoxyphenyl)propanoate (PubChem CID 21311724) has the molecular formula C15H10F3O3- and a molecular weight of 295.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(3-phenoxyphenyl)propanoate.
| Compound Name | 3,3,3-trifluoro-2-(3-phenoxyphenyl)propanoate |
|---|---|
| PubChem CID | 21311724 |
| Molecular Formula | C15H10F3O3- |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3,3,3-trifluoro-2-(3-phenoxyphenyl)propanoate |
| SMILES | O=C([O-])C(c1cccc(Oc2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C15H11F3O3/c16-15(17,18)13(14(19)20)10-5-4-8-12(9-10)21-11-6-2-1-3-7-11/h1-9,13H,(H,19,20)/p-1 |
| InChIKey | VNNVGDAEWCDYBU-UHFFFAOYSA-M |
| XLogP | 2.87 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |