C14H10F2O4 — CID 43651840
2,2-difluoro-2-(4-phenoxyphenoxy)acetic acid (PubChem CID 43651840) has the molecular formula C14H10F2O4 and a molecular weight of 280.23 g/mol. Its IUPAC name is 2,2-difluoro-2-(4-phenoxyphenoxy)acetic acid.
| Compound Name | 2,2-difluoro-2-(4-phenoxyphenoxy)acetic acid |
|---|---|
| PubChem CID | 43651840 |
| Molecular Formula | C14H10F2O4 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2,2-difluoro-2-(4-phenoxyphenoxy)acetic acid |
| SMILES | O=C(O)C(F)(F)Oc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C14H10F2O4/c15-14(16,13(17)18)20-12-8-6-11(7-9-12)19-10-4-2-1-3-5-10/h1-9H,(H,17,18) |
| InChIKey | DCOFOGRSIRQUSV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |