C15H10F6O — CID 154271060
1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-phenoxybenzene (PubChem CID 154271060) has the molecular formula C15H10F6O and a molecular weight of 320.23 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-phenoxybenzene.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-phenoxybenzene |
|---|---|
| PubChem CID | 154271060 |
| Molecular Formula | C15H10F6O |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yl)-4-phenoxybenzene |
| SMILES | FC(F)(F)C(c1ccc(Oc2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H10F6O/c16-14(17,18)13(15(19,20)21)10-6-8-12(9-7-10)22-11-4-2-1-3-5-11/h1-9,13H |
| InChIKey | BTNFCYXJAKOSQA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |