About iron;phenoxybenzene
iron;phenoxybenzene (PubChem CID 174434720) has the molecular formula C12H10FeO
and a molecular weight of 226.06 g/mol. Its IUPAC name is iron;phenoxybenzene.
Molecular Properties
| Compound Name | iron;phenoxybenzene |
| PubChem CID | 174434720 |
| Molecular Formula | C12H10FeO |
| Molecular Weight | 226.06 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | iron;phenoxybenzene |
| SMILES | [Fe].c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.Fe/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10H; |
| InChIKey | IDGDNKBDNMGERS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.06 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;phenoxybenzene?
The IUPAC name of iron;phenoxybenzene (CID 174434720) is iron;phenoxybenzene.
What is the SMILES notation for iron;phenoxybenzene?
The canonical SMILES for iron;phenoxybenzene is [Fe].c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of iron;phenoxybenzene?
The InChIKey is IDGDNKBDNMGERS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.Fe/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10H;.
What are the key properties of iron;phenoxybenzene?
iron;phenoxybenzene has a molecular weight of 226.06 g/mol, XLogP of 3.48, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iron;phenoxybenzene is sourced from PubChem (CID 174434720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).