About isocyanic acid;phenoxybenzene
isocyanic acid;phenoxybenzene (PubChem CID 174909585) has the molecular formula C19H17N7O8
and a molecular weight of 471.39 g/mol. Its IUPAC name is isocyanic acid;phenoxybenzene.
Molecular Properties
| Compound Name | isocyanic acid;phenoxybenzene |
| PubChem CID | 174909585 |
| Molecular Formula | C19H17N7O8 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | isocyanic acid;phenoxybenzene |
| SMILES | N=C=O.N=C=O.N=C=O.N=C=O.N=C=O.N=C=O.N=C=O.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.7CHNO/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7*2-1-3/h1-10H;7*2H |
| InChIKey | KSQFOTBAJHKQBG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 295.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanic acid;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanic acid;phenoxybenzene?
The IUPAC name of isocyanic acid;phenoxybenzene (CID 174909585) is isocyanic acid;phenoxybenzene.
What is the SMILES notation for isocyanic acid;phenoxybenzene?
The canonical SMILES for isocyanic acid;phenoxybenzene is N=C=O.N=C=O.N=C=O.N=C=O.N=C=O.N=C=O.N=C=O.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of isocyanic acid;phenoxybenzene?
The InChIKey is KSQFOTBAJHKQBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.7CHNO/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7*2-1-3/h1-10H;7*2H.
What are the key properties of isocyanic acid;phenoxybenzene?
isocyanic acid;phenoxybenzene has a molecular weight of 471.39 g/mol, XLogP of 2.79, 2 rotatable bonds, 7 hydrogen bond donors, and 15 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanic acid;phenoxybenzene is sourced from PubChem (CID 174909585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).