About oxophosphanium;phenoxybenzene
oxophosphanium;phenoxybenzene (PubChem CID 161329594) has the molecular formula C12H12O2P+
and a molecular weight of 219.20 g/mol. Its IUPAC name is oxophosphanium;phenoxybenzene.
Molecular Properties
| Compound Name | oxophosphanium;phenoxybenzene |
| PubChem CID | 161329594 |
| Molecular Formula | C12H12O2P+ |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | oxophosphanium;phenoxybenzene |
| SMILES | O=[PH2+].c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.H2OP/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2/h1-10H;2H2/q;+1 |
| InChIKey | NVBCTFAMSHWVKI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze oxophosphanium;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxophosphanium;phenoxybenzene?
The IUPAC name of oxophosphanium;phenoxybenzene (CID 161329594) is oxophosphanium;phenoxybenzene.
What is the SMILES notation for oxophosphanium;phenoxybenzene?
The canonical SMILES for oxophosphanium;phenoxybenzene is O=[PH2+].c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of oxophosphanium;phenoxybenzene?
The InChIKey is NVBCTFAMSHWVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.H2OP/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2/h1-10H;2H2/q;+1.
What are the key properties of oxophosphanium;phenoxybenzene?
oxophosphanium;phenoxybenzene has a molecular weight of 219.20 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for oxophosphanium;phenoxybenzene is sourced from PubChem (CID 161329594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).