About boric acid;phenoxybenzene
boric acid;phenoxybenzene (PubChem CID 66799508) has the molecular formula C12H13BO4
and a molecular weight of 232.04 g/mol. Its IUPAC name is boric acid;phenoxybenzene.
Molecular Properties
| Compound Name | boric acid;phenoxybenzene |
| PubChem CID | 66799508 |
| Molecular Formula | C12H13BO4 |
| Molecular Weight | 232.04 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | boric acid;phenoxybenzene |
| SMILES | OB(O)O.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.BH3O3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3)4/h1-10H;2-4H |
| InChIKey | RGQNERCTKUEFLR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.04 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;phenoxybenzene?
The IUPAC name of boric acid;phenoxybenzene (CID 66799508) is boric acid;phenoxybenzene.
What is the SMILES notation for boric acid;phenoxybenzene?
The canonical SMILES for boric acid;phenoxybenzene is OB(O)O.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of boric acid;phenoxybenzene?
The InChIKey is RGQNERCTKUEFLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.BH3O3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3)4/h1-10H;2-4H.
What are the key properties of boric acid;phenoxybenzene?
boric acid;phenoxybenzene has a molecular weight of 232.04 g/mol, XLogP of 1.43, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;phenoxybenzene is sourced from PubChem (CID 66799508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).