About potassium phenoxybenzene
potassium phenoxybenzene (PubChem CID 19858586) has the molecular formula C12H10KO+
and a molecular weight of 209.31 g/mol. Its IUPAC name is potassium phenoxybenzene.
Molecular Properties
| Compound Name | potassium phenoxybenzene |
| PubChem CID | 19858586 |
| Molecular Formula | C12H10KO+ |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | potassium phenoxybenzene |
| SMILES | [K+].c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.K/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10H;/q;+1 |
| InChIKey | ZOMQEJYNLMVMCC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze potassium phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium phenoxybenzene?
The IUPAC name of potassium phenoxybenzene (CID 19858586) is potassium phenoxybenzene.
What is the SMILES notation for potassium phenoxybenzene?
The canonical SMILES for potassium phenoxybenzene is [K+].c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of potassium phenoxybenzene?
The InChIKey is ZOMQEJYNLMVMCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.K/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10H;/q;+1.
What are the key properties of potassium phenoxybenzene?
potassium phenoxybenzene has a molecular weight of 209.31 g/mol, XLogP of 0.48, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium phenoxybenzene is sourced from PubChem (CID 19858586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).