About chlorobenzene;phenoxybenzene
chlorobenzene;phenoxybenzene (PubChem CID 66911253) has the molecular formula C18H15ClO
and a molecular weight of 282.77 g/mol. Its IUPAC name is chlorobenzene;phenoxybenzene.
Molecular Properties
| Compound Name | chlorobenzene;phenoxybenzene |
| PubChem CID | 66911253 |
| Molecular Formula | C18H15ClO |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | chlorobenzene;phenoxybenzene |
| SMILES | Clc1ccccc1.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C6H5Cl/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7-6-4-2-1-3-5-6/h1-10H;1-5H |
| InChIKey | FSQODDNAUDJQQE-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze chlorobenzene;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;phenoxybenzene?
The IUPAC name of chlorobenzene;phenoxybenzene (CID 66911253) is chlorobenzene;phenoxybenzene.
What is the SMILES notation for chlorobenzene;phenoxybenzene?
The canonical SMILES for chlorobenzene;phenoxybenzene is Clc1ccccc1.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of chlorobenzene;phenoxybenzene?
The InChIKey is FSQODDNAUDJQQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C6H5Cl/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7-6-4-2-1-3-5-6/h1-10H;1-5H.
What are the key properties of chlorobenzene;phenoxybenzene?
chlorobenzene;phenoxybenzene has a molecular weight of 282.77 g/mol, XLogP of 5.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;phenoxybenzene is sourced from PubChem (CID 66911253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).