C18H12Cl2O2 — CID 10996522
1,4-bis(4-chlorophenoxy)benzene (PubChem CID 10996522) has the molecular formula C18H12Cl2O2 and a molecular weight of 331.20 g/mol. Its IUPAC name is 1,4-bis(4-chlorophenoxy)benzene.
| Compound Name | 1,4-bis(4-chlorophenoxy)benzene |
|---|---|
| PubChem CID | 10996522 |
| Molecular Formula | C18H12Cl2O2 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 1,4-bis(4-chlorophenoxy)benzene |
| SMILES | Clc1ccc(Oc2ccc(Oc3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C18H12Cl2O2/c19-13-1-5-15(6-2-13)21-17-9-11-18(12-10-17)22-16-7-3-14(20)4-8-16/h1-12H |
| InChIKey | CDKWVMNRYRQMQW-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |