C12H7Cl3O2 — CID 21278927
2,6-dichloro-4-(4-chlorophenoxy)phenol (PubChem CID 21278927) has the molecular formula C12H7Cl3O2 and a molecular weight of 289.55 g/mol. Its IUPAC name is 2,6-dichloro-4-(4-chlorophenoxy)phenol.
| Compound Name | 2,6-dichloro-4-(4-chlorophenoxy)phenol |
|---|---|
| PubChem CID | 21278927 |
| Molecular Formula | C12H7Cl3O2 |
| Molecular Weight | 289.55 g/mol |
| Exact Mass | 287.95 |
| IUPAC Name | 2,6-dichloro-4-(4-chlorophenoxy)phenol |
| SMILES | Oc1c(Cl)cc(Oc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C12H7Cl3O2/c13-7-1-3-8(4-2-7)17-9-5-10(14)12(16)11(15)6-9/h1-6,16H |
| InChIKey | YFBATMUZUJHMGB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |