C12H10O4 — CID 14020516
5-phenoxybenzene-1,2,3-triol (PubChem CID 14020516) has the molecular formula C12H10O4 and a molecular weight of 218.21 g/mol. Its IUPAC name is 5-phenoxybenzene-1,2,3-triol.
| Compound Name | 5-phenoxybenzene-1,2,3-triol |
|---|---|
| PubChem CID | 14020516 |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 5-phenoxybenzene-1,2,3-triol |
| SMILES | Oc1cc(Oc2ccccc2)cc(O)c1O |
| InChI | InChI=1S/C12H10O4/c13-10-6-9(7-11(14)12(10)15)16-8-4-2-1-3-5-8/h1-7,13-15H |
| InChIKey | QDJCQQIIXRKENN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|