C18H14O4 — CID 90212443
4,6-diphenoxybenzene-1,3-diol (PubChem CID 90212443) has the molecular formula C18H14O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4,6-diphenoxybenzene-1,3-diol.
| Compound Name | 4,6-diphenoxybenzene-1,3-diol |
|---|---|
| PubChem CID | 90212443 |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4,6-diphenoxybenzene-1,3-diol |
| SMILES | Oc1cc(O)c(Oc2ccccc2)cc1Oc1ccccc1 |
| InChI | InChI=1S/C18H14O4/c19-15-11-16(20)18(22-14-9-5-2-6-10-14)12-17(15)21-13-7-3-1-4-8-13/h1-12,19-20H |
| InChIKey | KCPPGTSSNMVPBW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |