C18H16N2O2 — CID 139696987
2,5-diphenoxybenzene-1,4-diamine (PubChem CID 139696987) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2,5-diphenoxybenzene-1,4-diamine.
| Compound Name | 2,5-diphenoxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 139696987 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2,5-diphenoxybenzene-1,4-diamine |
| SMILES | Nc1cc(Oc2ccccc2)c(N)cc1Oc1ccccc1 |
| InChI | InChI=1S/C18H16N2O2/c19-15-12-18(22-14-9-5-2-6-10-14)16(20)11-17(15)21-13-7-3-1-4-8-13/h1-12H,19-20H2 |
| InChIKey | NKZLWCPLGFZLGI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|