C12H13N3O — CID 139667356
6-phenoxybenzene-1,2,4-triamine (PubChem CID 139667356) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 6-phenoxybenzene-1,2,4-triamine.
| Compound Name | 6-phenoxybenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 139667356 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 6-phenoxybenzene-1,2,4-triamine |
| SMILES | Nc1cc(N)c(N)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C12H13N3O/c13-8-6-10(14)12(15)11(7-8)16-9-4-2-1-3-5-9/h1-7H,13-15H2 |
| InChIKey | VYLRZQJLTVQJPZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|