About 2-iodo-4-phenoxyphenol
2-iodo-4-phenoxyphenol (PubChem CID 10710201) has the molecular formula C12H9IO2
and a molecular weight of 312.11 g/mol. Its IUPAC name is 2-iodo-4-phenoxyphenol.
Molecular Properties
| Compound Name | 2-iodo-4-phenoxyphenol |
| PubChem CID | 10710201 |
| Molecular Formula | C12H9IO2 |
| Molecular Weight | 312.11 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | 2-iodo-4-phenoxyphenol |
| SMILES | Oc1ccc(Oc2ccccc2)cc1I |
| InChI | InChI=1S/C12H9IO2/c13-11-8-10(6-7-12(11)14)15-9-4-2-1-3-5-9/h1-8,14H |
| InChIKey | KEXDEHPUIIAITA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.11 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-4-phenoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-4-phenoxyphenol?
The IUPAC name of 2-iodo-4-phenoxyphenol (CID 10710201) is 2-iodo-4-phenoxyphenol.
What is the SMILES notation for 2-iodo-4-phenoxyphenol?
The canonical SMILES for 2-iodo-4-phenoxyphenol is Oc1ccc(Oc2ccccc2)cc1I.
What is the InChIKey of 2-iodo-4-phenoxyphenol?
The InChIKey is KEXDEHPUIIAITA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9IO2/c13-11-8-10(6-7-12(11)14)15-9-4-2-1-3-5-9/h1-8,14H.
What are the key properties of 2-iodo-4-phenoxyphenol?
2-iodo-4-phenoxyphenol has a molecular weight of 312.11 g/mol, XLogP of 3.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-4-phenoxyphenol is sourced from PubChem (CID 10710201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).