About 2-nitro-4-phenoxyphenol
2-nitro-4-phenoxyphenol (PubChem CID 10775849) has the molecular formula C12H9NO4
and a molecular weight of 231.21 g/mol. Its IUPAC name is 2-nitro-4-phenoxyphenol.
Molecular Properties
| Compound Name | 2-nitro-4-phenoxyphenol |
| PubChem CID | 10775849 |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-nitro-4-phenoxyphenol |
| SMILES | O=[N+]([O-])c1cc(Oc2ccccc2)ccc1O |
| InChI | InChI=1S/C12H9NO4/c14-12-7-6-10(8-11(12)13(15)16)17-9-4-2-1-3-5-9/h1-8,14H |
| InChIKey | PVFPTCXTEHFQGM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-4-phenoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-4-phenoxyphenol?
The IUPAC name of 2-nitro-4-phenoxyphenol (CID 10775849) is 2-nitro-4-phenoxyphenol.
What is the SMILES notation for 2-nitro-4-phenoxyphenol?
The canonical SMILES for 2-nitro-4-phenoxyphenol is O=[N+]([O-])c1cc(Oc2ccccc2)ccc1O.
What is the InChIKey of 2-nitro-4-phenoxyphenol?
The InChIKey is PVFPTCXTEHFQGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO4/c14-12-7-6-10(8-11(12)13(15)16)17-9-4-2-1-3-5-9/h1-8,14H.
What are the key properties of 2-nitro-4-phenoxyphenol?
2-nitro-4-phenoxyphenol has a molecular weight of 231.21 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-4-phenoxyphenol is sourced from PubChem (CID 10775849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).