About 2-nitro-4-phenoxyaniline;N-(2-nitro-4-phenoxyphenyl)acetamide
2-nitro-4-phenoxyaniline;N-(2-nitro-4-phenoxyphenyl)acetamide (PubChem CID 158109560) has the molecular formula C26H22N4O7
and a molecular weight of 502.48 g/mol. Its IUPAC name is 2-nitro-4-phenoxyaniline;N-(2-nitro-4-phenoxyphenyl)acetamide.
Molecular Properties
| Compound Name | 2-nitro-4-phenoxyaniline;N-(2-nitro-4-phenoxyphenyl)acetamide |
| PubChem CID | 158109560 |
| Molecular Formula | C26H22N4O7 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 2-nitro-4-phenoxyaniline;N-(2-nitro-4-phenoxyphenyl)acetamide |
| SMILES | CC(=O)Nc1ccc(Oc2ccccc2)cc1[N+](=O)[O-].Nc1ccc(Oc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N2O4.C12H10N2O3/c1-10(17)15-13-8-7-12(9-14(13)16(18)19)20-11-5-3-2-4-6-11;13-11-7-6-10(8-12(11)14(15)16)17-9-4-2-1-3-5-9/h2-9H,1H3,(H,15,17);1-8H,13H2 |
| InChIKey | FQGIRBYMZZOFHO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 159.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-4-phenoxyaniline;N-(2-nitro-4-phenoxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-4-phenoxyaniline;N-(2-nitro-4-phenoxyphenyl)acetamide?
The IUPAC name of 2-nitro-4-phenoxyaniline;N-(2-nitro-4-phenoxyphenyl)acetamide (CID 158109560) is 2-nitro-4-phenoxyaniline;N-(2-nitro-4-phenoxyphenyl)acetamide.
What is the SMILES notation for 2-nitro-4-phenoxyaniline;N-(2-nitro-4-phenoxyphenyl)acetamide?
The canonical SMILES for 2-nitro-4-phenoxyaniline;N-(2-nitro-4-phenoxyphenyl)acetamide is CC(=O)Nc1ccc(Oc2ccccc2)cc1[N+](=O)[O-].Nc1ccc(Oc2ccccc2)cc1[N+](=O)[O-].
What is the InChIKey of 2-nitro-4-phenoxyaniline;N-(2-nitro-4-phenoxyphenyl)acetamide?
The InChIKey is FQGIRBYMZZOFHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O4.C12H10N2O3/c1-10(17)15-13-8-7-12(9-14(13)16(18)19)20-11-5-3-2-4-6-11;13-11-7-6-10(8-12(11)14(15)16)17-9-4-2-1-3-5-9/h2-9H,1H3,(H,15,17);1-8H,13H2.
What are the key properties of 2-nitro-4-phenoxyaniline;N-(2-nitro-4-phenoxyphenyl)acetamide?
2-nitro-4-phenoxyaniline;N-(2-nitro-4-phenoxyphenyl)acetamide has a molecular weight of 502.48 g/mol, XLogP of 6.31, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-4-phenoxyaniline;N-(2-nitro-4-phenoxyphenyl)acetamide is sourced from PubChem (CID 158109560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).