About 4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;3-oxo-N-phenylbutanamide
4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;3-oxo-N-phenylbutanamide (PubChem CID 88796241) has the molecular formula C23H23N5O8
and a molecular weight of 497.46 g/mol. Its IUPAC name is 4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;3-oxo-N-phenylbutanamide.
Molecular Properties
| Compound Name | 4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;3-oxo-N-phenylbutanamide |
| PubChem CID | 88796241 |
| Molecular Formula | C23H23N5O8 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;3-oxo-N-phenylbutanamide |
| SMILES | CC(=O)CC(=O)Nc1ccccc1.Nc1ccc(OCOc2ccc(N)c([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N4O6.C10H11NO2/c14-10-3-1-8(5-12(10)16(18)19)22-7-23-9-2-4-11(15)13(6-9)17(20)21;1-8(12)7-10(13)11-9-5-3-2-4-6-9/h1-6H,7,14-15H2;2-6H,7H2,1H3,(H,11,13) |
| InChIKey | FUVIFFIRUMBSEK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 202.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;3-oxo-N-phenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;3-oxo-N-phenylbutanamide?
The IUPAC name of 4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;3-oxo-N-phenylbutanamide (CID 88796241) is 4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;3-oxo-N-phenylbutanamide.
What is the SMILES notation for 4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;3-oxo-N-phenylbutanamide?
The canonical SMILES for 4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;3-oxo-N-phenylbutanamide is CC(=O)CC(=O)Nc1ccccc1.Nc1ccc(OCOc2ccc(N)c([N+](=O)[O-])c2)cc1[N+](=O)[O-].
What is the InChIKey of 4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;3-oxo-N-phenylbutanamide?
The InChIKey is FUVIFFIRUMBSEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4O6.C10H11NO2/c14-10-3-1-8(5-12(10)16(18)19)22-7-23-9-2-4-11(15)13(6-9)17(20)21;1-8(12)7-10(13)11-9-5-3-2-4-6-9/h1-6H,7,14-15H2;2-6H,7H2,1H3,(H,11,13).
What are the key properties of 4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;3-oxo-N-phenylbutanamide?
4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;3-oxo-N-phenylbutanamide has a molecular weight of 497.46 g/mol, XLogP of 3.69, 9 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;3-oxo-N-phenylbutanamide is sourced from PubChem (CID 88796241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).