C24H25N5O9 — CID 88800356
4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;1-(2-aminophenoxy)pentane-2,4-dione (PubChem CID 88800356) has the molecular formula C24H25N5O9 and a molecular weight of 527.49 g/mol. Its IUPAC name is 4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;1-(2-aminophenoxy)pentane-2,4-dione.
| Compound Name | 4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;1-(2-aminophenoxy)pentane-2,4-dione |
|---|---|
| PubChem CID | 88800356 |
| Molecular Formula | C24H25N5O9 |
| Molecular Weight | 527.49 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | 4-[(4-amino-3-nitrophenoxy)methoxy]-2-nitroaniline;1-(2-aminophenoxy)pentane-2,4-dione |
| SMILES | CC(=O)CC(=O)COc1ccccc1N.Nc1ccc(OCOc2ccc(N)c([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N4O6.C11H13NO3/c14-10-3-1-8(5-12(10)16(18)19)22-7-23-9-2-4-11(15)13(6-9)17(20)21;1-8(13)6-9(14)7-15-11-5-3-2-4-10(11)12/h1-6H,7,14-15H2;2-5H,6-7,12H2,1H3 |
| InChIKey | MUVBBOMYDYFZEO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 226.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|