About acetic acid;3-oxo-N-phenylbutanamide
acetic acid;3-oxo-N-phenylbutanamide (PubChem CID 160598921) has the molecular formula C12H15NO4
and a molecular weight of 237.26 g/mol. Its IUPAC name is acetic acid;3-oxo-N-phenylbutanamide.
Molecular Properties
| Compound Name | acetic acid;3-oxo-N-phenylbutanamide |
| PubChem CID | 160598921 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | acetic acid;3-oxo-N-phenylbutanamide |
| SMILES | CC(=O)CC(=O)Nc1ccccc1.CC(=O)O |
| InChI | InChI=1S/C10H11NO2.C2H4O2/c1-8(12)7-10(13)11-9-5-3-2-4-6-9;1-2(3)4/h2-6H,7H2,1H3,(H,11,13);1H3,(H,3,4) |
| InChIKey | RDZYLLUTEBROSG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;3-oxo-N-phenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;3-oxo-N-phenylbutanamide?
The IUPAC name of acetic acid;3-oxo-N-phenylbutanamide (CID 160598921) is acetic acid;3-oxo-N-phenylbutanamide.
What is the SMILES notation for acetic acid;3-oxo-N-phenylbutanamide?
The canonical SMILES for acetic acid;3-oxo-N-phenylbutanamide is CC(=O)CC(=O)Nc1ccccc1.CC(=O)O.
What is the InChIKey of acetic acid;3-oxo-N-phenylbutanamide?
The InChIKey is RDZYLLUTEBROSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2.C2H4O2/c1-8(12)7-10(13)11-9-5-3-2-4-6-9;1-2(3)4/h2-6H,7H2,1H3,(H,11,13);1H3,(H,3,4).
What are the key properties of acetic acid;3-oxo-N-phenylbutanamide?
acetic acid;3-oxo-N-phenylbutanamide has a molecular weight of 237.26 g/mol, XLogP of 1.70, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-oxo-N-phenylbutanamide is sourced from PubChem (CID 160598921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).