About 1-(4-acetylphenyl)propan-1-one;ethane;3-oxo-N-phenylbutanamide
1-(4-acetylphenyl)propan-1-one;ethane;3-oxo-N-phenylbutanamide (PubChem CID 174808780) has the molecular formula C23H29NO4
and a molecular weight of 383.49 g/mol. Its IUPAC name is 1-(4-acetylphenyl)propan-1-one;ethane;3-oxo-N-phenylbutanamide.
Molecular Properties
| Compound Name | 1-(4-acetylphenyl)propan-1-one;ethane;3-oxo-N-phenylbutanamide |
| PubChem CID | 174808780 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 1-(4-acetylphenyl)propan-1-one;ethane;3-oxo-N-phenylbutanamide |
| SMILES | CC.CC(=O)CC(=O)Nc1ccccc1.CCC(=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C11H12O2.C10H11NO2.C2H6/c1-3-11(13)10-6-4-9(5-7-10)8(2)12;1-8(12)7-10(13)11-9-5-3-2-4-6-9;1-2/h4-7H,3H2,1-2H3;2-6H,7H2,1H3,(H,11,13);1-2H3 |
| InChIKey | ZNKIQWSMHHXLMJ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-acetylphenyl)propan-1-one;ethane;3-oxo-N-phenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-acetylphenyl)propan-1-one;ethane;3-oxo-N-phenylbutanamide?
The IUPAC name of 1-(4-acetylphenyl)propan-1-one;ethane;3-oxo-N-phenylbutanamide (CID 174808780) is 1-(4-acetylphenyl)propan-1-one;ethane;3-oxo-N-phenylbutanamide.
What is the SMILES notation for 1-(4-acetylphenyl)propan-1-one;ethane;3-oxo-N-phenylbutanamide?
The canonical SMILES for 1-(4-acetylphenyl)propan-1-one;ethane;3-oxo-N-phenylbutanamide is CC.CC(=O)CC(=O)Nc1ccccc1.CCC(=O)c1ccc(C(C)=O)cc1.
What is the InChIKey of 1-(4-acetylphenyl)propan-1-one;ethane;3-oxo-N-phenylbutanamide?
The InChIKey is ZNKIQWSMHHXLMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2.C10H11NO2.C2H6/c1-3-11(13)10-6-4-9(5-7-10)8(2)12;1-8(12)7-10(13)11-9-5-3-2-4-6-9;1-2/h4-7H,3H2,1-2H3;2-6H,7H2,1H3,(H,11,13);1-2H3.
What are the key properties of 1-(4-acetylphenyl)propan-1-one;ethane;3-oxo-N-phenylbutanamide?
1-(4-acetylphenyl)propan-1-one;ethane;3-oxo-N-phenylbutanamide has a molecular weight of 383.49 g/mol, XLogP of 5.11, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-acetylphenyl)propan-1-one;ethane;3-oxo-N-phenylbutanamide is sourced from PubChem (CID 174808780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).