About ethane;methane;N-phenylpropanamide
ethane;methane;N-phenylpropanamide (PubChem CID 159778408) has the molecular formula C16H33NO
and a molecular weight of 255.45 g/mol. Its IUPAC name is ethane;methane;N-phenylpropanamide.
Molecular Properties
| Compound Name | ethane;methane;N-phenylpropanamide |
| PubChem CID | 159778408 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | ethane;methane;N-phenylpropanamide |
| SMILES | C.CC.CC.CC.CCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C9H11NO.3C2H6.CH4/c1-2-9(11)10-8-6-4-3-5-7-8;3*1-2;/h3-7H,2H2,1H3,(H,10,11);3*1-2H3;1H4 |
| InChIKey | NHARUOAYLYYXIO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;methane;N-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;N-phenylpropanamide?
The IUPAC name of ethane;methane;N-phenylpropanamide (CID 159778408) is ethane;methane;N-phenylpropanamide.
What is the SMILES notation for ethane;methane;N-phenylpropanamide?
The canonical SMILES for ethane;methane;N-phenylpropanamide is C.CC.CC.CC.CCC(=O)Nc1ccccc1.
What is the InChIKey of ethane;methane;N-phenylpropanamide?
The InChIKey is NHARUOAYLYYXIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.3C2H6.CH4/c1-2-9(11)10-8-6-4-3-5-7-8;3*1-2;/h3-7H,2H2,1H3,(H,10,11);3*1-2H3;1H4.
What are the key properties of ethane;methane;N-phenylpropanamide?
ethane;methane;N-phenylpropanamide has a molecular weight of 255.45 g/mol, XLogP of 5.75, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;N-phenylpropanamide is sourced from PubChem (CID 159778408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).