C11H11NO3 — CID 121217123
3-oxo-N-(7-oxocyclohepta-1,3,5-trien-1-yl)butanamide (PubChem CID 121217123) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 3-oxo-N-(7-oxocyclohepta-1,3,5-trien-1-yl)butanamide.
| Compound Name | 3-oxo-N-(7-oxocyclohepta-1,3,5-trien-1-yl)butanamide |
|---|---|
| PubChem CID | 121217123 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3-oxo-N-(7-oxocyclohepta-1,3,5-trien-1-yl)butanamide |
| SMILES | CC(=O)CC(=O)Nc1cccccc1=O |
| InChI | InChI=1S/C11H11NO3/c1-8(13)7-11(15)12-9-5-3-2-4-6-10(9)14/h2-6H,7H2,1H3,(H,12,14,15) |
| InChIKey | ZXDIMCSDJHZPEW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|