About cobalt;N-phenylacetamide
cobalt;N-phenylacetamide (PubChem CID 158689050) has the molecular formula C8H9CoNO
and a molecular weight of 194.10 g/mol. Its IUPAC name is cobalt;N-phenylacetamide.
Molecular Properties
| Compound Name | cobalt;N-phenylacetamide |
| PubChem CID | 158689050 |
| Molecular Formula | C8H9CoNO |
| Molecular Weight | 194.10 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | cobalt;N-phenylacetamide |
| SMILES | CC(=O)Nc1ccccc1.[Co] |
| InChI | InChI=1S/C8H9NO.Co/c1-7(10)9-8-5-3-2-4-6-8;/h2-6H,1H3,(H,9,10); |
| InChIKey | IGCNYMVBMWJLMI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.10 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cobalt;N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;N-phenylacetamide?
The IUPAC name of cobalt;N-phenylacetamide (CID 158689050) is cobalt;N-phenylacetamide.
What is the SMILES notation for cobalt;N-phenylacetamide?
The canonical SMILES for cobalt;N-phenylacetamide is CC(=O)Nc1ccccc1.[Co].
What is the InChIKey of cobalt;N-phenylacetamide?
The InChIKey is IGCNYMVBMWJLMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.Co/c1-7(10)9-8-5-3-2-4-6-8;/h2-6H,1H3,(H,9,10);.
What are the key properties of cobalt;N-phenylacetamide?
cobalt;N-phenylacetamide has a molecular weight of 194.10 g/mol, XLogP of 1.64, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;N-phenylacetamide is sourced from PubChem (CID 158689050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).