About N-phenylacetamide;toluene
N-phenylacetamide;toluene (PubChem CID 175205531) has the molecular formula C15H17NO
and a molecular weight of 227.31 g/mol. Its IUPAC name is N-phenylacetamide;toluene.
Molecular Properties
| Compound Name | N-phenylacetamide;toluene |
| PubChem CID | 175205531 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-phenylacetamide;toluene |
| SMILES | CC(=O)Nc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C8H9NO.C7H8/c1-7(10)9-8-5-3-2-4-6-8;1-7-5-3-2-4-6-7/h2-6H,1H3,(H,9,10);2-6H,1H3 |
| InChIKey | UOVYTMACSNGCHK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-phenylacetamide;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylacetamide;toluene?
The IUPAC name of N-phenylacetamide;toluene (CID 175205531) is N-phenylacetamide;toluene.
What is the SMILES notation for N-phenylacetamide;toluene?
The canonical SMILES for N-phenylacetamide;toluene is CC(=O)Nc1ccccc1.Cc1ccccc1.
What is the InChIKey of N-phenylacetamide;toluene?
The InChIKey is UOVYTMACSNGCHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C7H8/c1-7(10)9-8-5-3-2-4-6-8;1-7-5-3-2-4-6-7/h2-6H,1H3,(H,9,10);2-6H,1H3.
What are the key properties of N-phenylacetamide;toluene?
N-phenylacetamide;toluene has a molecular weight of 227.31 g/mol, XLogP of 3.64, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylacetamide;toluene is sourced from PubChem (CID 175205531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).