About N-methylethanamine;N-phenylacetamide
N-methylethanamine;N-phenylacetamide (PubChem CID 156841550) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is N-methylethanamine;N-phenylacetamide.
Molecular Properties
| Compound Name | N-methylethanamine;N-phenylacetamide |
| PubChem CID | 156841550 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-methylethanamine;N-phenylacetamide |
| SMILES | CC(=O)Nc1ccccc1.CCNC |
| InChI | InChI=1S/C8H9NO.C3H9N/c1-7(10)9-8-5-3-2-4-6-8;1-3-4-2/h2-6H,1H3,(H,9,10);4H,3H2,1-2H3 |
| InChIKey | TVAIBMJDBKKZFY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methylethanamine;N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylethanamine;N-phenylacetamide?
The IUPAC name of N-methylethanamine;N-phenylacetamide (CID 156841550) is N-methylethanamine;N-phenylacetamide.
What is the SMILES notation for N-methylethanamine;N-phenylacetamide?
The canonical SMILES for N-methylethanamine;N-phenylacetamide is CC(=O)Nc1ccccc1.CCNC.
What is the InChIKey of N-methylethanamine;N-phenylacetamide?
The InChIKey is TVAIBMJDBKKZFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C3H9N/c1-7(10)9-8-5-3-2-4-6-8;1-3-4-2/h2-6H,1H3,(H,9,10);4H,3H2,1-2H3.
What are the key properties of N-methylethanamine;N-phenylacetamide?
N-methylethanamine;N-phenylacetamide has a molecular weight of 194.28 g/mol, XLogP of 1.87, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylethanamine;N-phenylacetamide is sourced from PubChem (CID 156841550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).