About 1-methyl-3-phenylurea;propane
1-methyl-3-phenylurea;propane (PubChem CID 142949663) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-methyl-3-phenylurea;propane.
Molecular Properties
| Compound Name | 1-methyl-3-phenylurea;propane |
| PubChem CID | 142949663 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-methyl-3-phenylurea;propane |
| SMILES | CCC.CNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C8H10N2O.C3H8/c1-9-8(11)10-7-5-3-2-4-6-7;1-3-2/h2-6H,1H3,(H2,9,10,11);3H2,1-2H3 |
| InChIKey | VHRMQKPOIUZRIF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-3-phenylurea;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-phenylurea;propane?
The IUPAC name of 1-methyl-3-phenylurea;propane (CID 142949663) is 1-methyl-3-phenylurea;propane.
What is the SMILES notation for 1-methyl-3-phenylurea;propane?
The canonical SMILES for 1-methyl-3-phenylurea;propane is CCC.CNC(=O)Nc1ccccc1.
What is the InChIKey of 1-methyl-3-phenylurea;propane?
The InChIKey is VHRMQKPOIUZRIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O.C3H8/c1-9-8(11)10-7-5-3-2-4-6-7;1-3-2/h2-6H,1H3,(H2,9,10,11);3H2,1-2H3.
What are the key properties of 1-methyl-3-phenylurea;propane?
1-methyl-3-phenylurea;propane has a molecular weight of 194.28 g/mol, XLogP of 2.85, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-phenylurea;propane is sourced from PubChem (CID 142949663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).