C13H18ClN3O2 — CID 63680187
3-chloro-2,2-dimethyl-N-[4-(methylcarbamoylamino)phenyl]propanamide (PubChem CID 63680187) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[4-(methylcarbamoylamino)phenyl]propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-[4-(methylcarbamoylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 63680187 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[4-(methylcarbamoylamino)phenyl]propanamide |
| SMILES | CNC(=O)Nc1ccc(NC(=O)C(C)(C)CCl)cc1 |
| InChI | InChI=1S/C13H18ClN3O2/c1-13(2,8-14)11(18)16-9-4-6-10(7-5-9)17-12(19)15-3/h4-7H,8H2,1-3H3,(H,16,18)(H2,15,17,19) |
| InChIKey | GTCPLJJXCSYZSH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|