C12H14ClF2NOS — CID 60723044
3-chloro-N-[4-(difluoromethylsulfanyl)phenyl]-2,2-dimethylpropanamide (PubChem CID 60723044) has the molecular formula C12H14ClF2NOS and a molecular weight of 293.77 g/mol. Its IUPAC name is 3-chloro-N-[4-(difluoromethylsulfanyl)phenyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[4-(difluoromethylsulfanyl)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 60723044 |
| Molecular Formula | C12H14ClF2NOS |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 3-chloro-N-[4-(difluoromethylsulfanyl)phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C12H14ClF2NOS/c1-12(2,7-13)10(17)16-8-3-5-9(6-4-8)18-11(14)15/h3-6,11H,7H2,1-2H3,(H,16,17) |
| InChIKey | KLSGPGPXKMIOGA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|