C13H18F2N2OS — CID 62851819
N-[4-(difluoromethylsulfanyl)phenyl]-3-(ethylamino)-2-methylpropanamide (PubChem CID 62851819) has the molecular formula C13H18F2N2OS and a molecular weight of 288.36 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-3-(ethylamino)-2-methylpropanamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-3-(ethylamino)-2-methylpropanamide |
|---|---|
| PubChem CID | 62851819 |
| Molecular Formula | C13H18F2N2OS |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-3-(ethylamino)-2-methylpropanamide |
| SMILES | CCNCC(C)C(=O)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C13H18F2N2OS/c1-3-16-8-9(2)12(18)17-10-4-6-11(7-5-10)19-13(14)15/h4-7,9,13,16H,3,8H2,1-2H3,(H,17,18) |
| InChIKey | XWFQPDKDBPLZNI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |