C18H18ClF2NOS — CID 7944876
(2S)-2-(4-chlorophenyl)-N-[4-(difluoromethylsulfanyl)phenyl]-3-methylbutanamide (PubChem CID 7944876) has the molecular formula C18H18ClF2NOS and a molecular weight of 369.86 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-N-[4-(difluoromethylsulfanyl)phenyl]-3-methylbutanamide.
| Compound Name | (2S)-2-(4-chlorophenyl)-N-[4-(difluoromethylsulfanyl)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 7944876 |
| Molecular Formula | C18H18ClF2NOS |
| Molecular Weight | 369.86 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-N-[4-(difluoromethylsulfanyl)phenyl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](C(=O)Nc1ccc(SC(F)F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClF2NOS/c1-11(2)16(12-3-5-13(19)6-4-12)17(23)22-14-7-9-15(10-8-14)24-18(20)21/h3-11,16,18H,1-2H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | YQUVGJIIFUBVNE-INIZCTEOSA-N |
| XLogP | 6.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.86 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |