C18H17ClF3NO — CID 42909302
2-(4-chlorophenyl)-3-methyl-N-[4-(trifluoromethyl)phenyl]butanamide (PubChem CID 42909302) has the molecular formula C18H17ClF3NO and a molecular weight of 355.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-methyl-N-[4-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 2-(4-chlorophenyl)-3-methyl-N-[4-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 42909302 |
| Molecular Formula | C18H17ClF3NO |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-(4-chlorophenyl)-3-methyl-N-[4-(trifluoromethyl)phenyl]butanamide |
| SMILES | CC(C)C(C(=O)Nc1ccc(C(F)(F)F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17ClF3NO/c1-11(2)16(12-3-7-14(19)8-4-12)17(24)23-15-9-5-13(6-10-15)18(20,21)22/h3-11,16H,1-2H3,(H,23,24) |
| InChIKey | ZFNYOCQLNGBTLA-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |