C22H27ClN2O2 — CID 8503860
4-[[(2R)-2-(4-chlorophenyl)-3-methylbutanoyl]amino]-N,N-diethylbenzamide (PubChem CID 8503860) has the molecular formula C22H27ClN2O2 and a molecular weight of 386.92 g/mol. Its IUPAC name is 4-[[(2R)-2-(4-chlorophenyl)-3-methylbutanoyl]amino]-N,N-diethylbenzamide.
| Compound Name | 4-[[(2R)-2-(4-chlorophenyl)-3-methylbutanoyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 8503860 |
| Molecular Formula | C22H27ClN2O2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 4-[[(2R)-2-(4-chlorophenyl)-3-methylbutanoyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)[C@@H](c2ccc(Cl)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C22H27ClN2O2/c1-5-25(6-2)22(27)17-9-13-19(14-10-17)24-21(26)20(15(3)4)16-7-11-18(23)12-8-16/h7-15,20H,5-6H2,1-4H3,(H,24,26)/t20-/m1/s1 |
| InChIKey | RWEZRCWSXDTUIL-HXUWFJFHSA-N |
| XLogP | 5.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |