C25H24ClNO2 — CID 10740078
N-(4-chlorophenyl)-3-methyl-2,4-bis(4-methylphenyl)-4-oxobutanamide (PubChem CID 10740078) has the molecular formula C25H24ClNO2 and a molecular weight of 405.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-methyl-2,4-bis(4-methylphenyl)-4-oxobutanamide.
| Compound Name | N-(4-chlorophenyl)-3-methyl-2,4-bis(4-methylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 10740078 |
| Molecular Formula | C25H24ClNO2 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-(4-chlorophenyl)-3-methyl-2,4-bis(4-methylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(C(=O)C(C)C(C(=O)Nc2ccc(Cl)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H24ClNO2/c1-16-4-8-19(9-5-16)23(25(29)27-22-14-12-21(26)13-15-22)18(3)24(28)20-10-6-17(2)7-11-20/h4-15,18,23H,1-3H3,(H,27,29) |
| InChIKey | WTSMKIPOVYUBQR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |