C25H26ClNO4 — CID 138961605
3-acetyl-4-(4-chlorobenzoyl)-5-[1-(4-methylanilino)ethylidene]heptane-2,6-dione (PubChem CID 138961605) has the molecular formula C25H26ClNO4 and a molecular weight of 439.94 g/mol. Its IUPAC name is 3-acetyl-4-(4-chlorobenzoyl)-5-[1-(4-methylanilino)ethylidene]heptane-2,6-dione.
| Compound Name | 3-acetyl-4-(4-chlorobenzoyl)-5-[1-(4-methylanilino)ethylidene]heptane-2,6-dione |
|---|---|
| PubChem CID | 138961605 |
| Molecular Formula | C25H26ClNO4 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 3-acetyl-4-(4-chlorobenzoyl)-5-[1-(4-methylanilino)ethylidene]heptane-2,6-dione |
| SMILES | CC(=O)C(=C(C)Nc1ccc(C)cc1)C(C(=O)c1ccc(Cl)cc1)C(C(C)=O)C(C)=O |
| InChI | InChI=1S/C25H26ClNO4/c1-14-6-12-21(13-7-14)27-15(2)22(16(3)28)24(23(17(4)29)18(5)30)25(31)19-8-10-20(26)11-9-19/h6-13,23-24,27H,1-5H3 |
| InChIKey | MHALDRYGYSZPGZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|