About N-(4-acetylphenyl)-N'-(4-chlorophenyl)oxamide
N-(4-acetylphenyl)-N'-(4-chlorophenyl)oxamide (PubChem CID 108514724) has the molecular formula C16H13ClN2O3
and a molecular weight of 316.74 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N'-(4-chlorophenyl)oxamide.
Molecular Properties
| Compound Name | N-(4-acetylphenyl)-N'-(4-chlorophenyl)oxamide |
| PubChem CID | 108514724 |
| Molecular Formula | C16H13ClN2O3 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | N-(4-acetylphenyl)-N'-(4-chlorophenyl)oxamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H13ClN2O3/c1-10(20)11-2-6-13(7-3-11)18-15(21)16(22)19-14-8-4-12(17)5-9-14/h2-9H,1H3,(H,18,21)(H,19,22) |
| InChIKey | PTIPLUHKDTYMDT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(4-acetylphenyl)-N'-(4-chlorophenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-acetylphenyl)-N'-(4-chlorophenyl)oxamide?
The IUPAC name of N-(4-acetylphenyl)-N'-(4-chlorophenyl)oxamide (CID 108514724) is N-(4-acetylphenyl)-N'-(4-chlorophenyl)oxamide.
What is the SMILES notation for N-(4-acetylphenyl)-N'-(4-chlorophenyl)oxamide?
The canonical SMILES for N-(4-acetylphenyl)-N'-(4-chlorophenyl)oxamide is CC(=O)c1ccc(NC(=O)C(=O)Nc2ccc(Cl)cc2)cc1.
What is the InChIKey of N-(4-acetylphenyl)-N'-(4-chlorophenyl)oxamide?
The InChIKey is PTIPLUHKDTYMDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClN2O3/c1-10(20)11-2-6-13(7-3-11)18-15(21)16(22)19-14-8-4-12(17)5-9-14/h2-9H,1H3,(H,18,21)(H,19,22).
What are the key properties of N-(4-acetylphenyl)-N'-(4-chlorophenyl)oxamide?
N-(4-acetylphenyl)-N'-(4-chlorophenyl)oxamide has a molecular weight of 316.74 g/mol, XLogP of 3.12, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-acetylphenyl)-N'-(4-chlorophenyl)oxamide is sourced from PubChem (CID 108514724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).